| Identification | |
| Name: | Pyrazine,2-methoxy-3-(1-methylpropyl)- |
| Synonyms: | Pyrazine,2-sec-butyl-3-methoxy- (8CI);2-Methoxy-3-(1-methylpropyl)pyrazine;2-Methoxy-3-sec-butylpyrazine;2-s-Butyl-3-methoxypyrazine;2-sec-Butyl-3-methoxypyrazine;3-sec-Butyl-2-methoxypyrazine; |
| CAS: | 24168-70-5 |
| EINECS: | 246-050-9 |
| Molecular Formula: | C9H14N2O |
| Molecular Weight: | 166.22 |
| InChI: | InChI=1/C9H14N2O/c1-4-7(2)8-9(12-3)11-6-5-10-8/h5-7H,4H2,1-3H3/t7-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.99 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | n20/D 1.492(lit.) |
| Appearance: | Colorless liquid. |
| Specification: |
?2-Methoxy-3-sec-butyl pyrazine , its CAS NO. is 24168-70-5, the synonyms are 2-Methoxy-3-(1-methylpropyl)pyrazine ; 2-sec-Butyl-3-methoxypyrazine ; Pyrazine, 2-methoxy-3-(1-methylpropyl)- ; Pyrazine, 2-sec-butyl-3-methoxy- . |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A compound contents in musts and wines from Vitis vinifera variety Cabernet Sauvignon |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
