| Identification | |
| Name: | 1-Benzyl-piperidine-4-carboxylic acid ethyl ester |
| Synonyms: | Isonipecoticacid, 1-benzyl-, ethyl ester (8CI);1-(Phenylmethyl)piperidine-4-carboxylicacid ethyl ester;1-Benzyl-4-carboethoxypiperidine;Ethyl 1-benzylisonipecotate;Ethyl N-benzylisonipecotate;4-Piperidinecarboxylicacid, 1-(phenylmethyl)-, ethyl ester; |
| CAS: | 24228-40-8 |
| EINECS: | 246-094-9 |
| Molecular Formula: | C15H21NO2 |
| Molecular Weight: | 247.33 |
| InChI: | InChI=1/C15H21NO2/c1-2-18-15(17)14-8-10-16(11-9-14)12-13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.7 ºC |
| Density: | 1.075 g/cm3 |
| Refractive index: | 1.533 |
| Appearance: | Colorless or yellowish liquid |
| Specification: |
1-Benzyl-piperidine-4-carboxylic acid ethyl ester , with CAS number of 24228-40-8, can be called 4-piperidinecarboxylic acid, 1-(phenylmethyl)-, ethyl ester ; Ethyl 1-benzylpiperidine-4-carboxylate ; Ethyl 1-benzylisonipecotate ; Ethyl 1-benzylpiperidine-4-carboxylate 96% ; N-Benzyl-4-carboethoxypiperidine . It is a kind of colourless oil. |
| Flash Point: | 110.7 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
