| Identification | |
| Name: | 1-Naphthalenecarboxylicacid, 6-hydroxy- |
| Synonyms: | 1-Naphthoicacid, 6-hydroxy- (7CI,8CI); 6-Hydroxy-1-naphthalenecarboxylic acid;6-Hydroxy-1-naphthoic acid |
| CAS: | 2437-17-4 |
| EINECS: | 407-390-5 |
| Molecular Formula: | C11H8 O3 |
| Molecular Weight: | 188.18 |
| InChI: | InChI=1/C11H8O3/c12-8-4-5-9-7(6-8)2-1-3-10(9)11(13)14/h1-6,12H,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 210 ºC |
| Flash Point: | 237.5°C |
| Boiling Point: | 445.7°C at 760 mmHg |
| Density: | 1.399g/cm3 |
| Refractive index: | 1.716 |
| Appearance: | White to light yellow crystal powder |
| Specification: |
6-Hydroxy-1-naphthoic acid , its cas register number is 2437-17-4. It also can be called 6-Hydroxynaphthoic Acid ; 6-Hydroxynaphthalene-1-Carboxylic Acid ; 6-Hydroxy-1-Naphthalenecarboxylic Acid . And, It is a white to light yellow crystal powder. |
| Flash Point: | 237.5°C |
| Safety Data | |
 |
|
