| Identification | |
| Name: | Bufexamac |
| Synonyms: | 4-Butoxy-N-hydroxybenzeneacetamide;p-Butoxyphenylacetohydroxamic acid;Benzeneacetamide, 4-butoxy-N-hydroxy- (9CI); |
| CAS: | 2438-72-4 |
| EINECS: | 219-451-1 |
| Molecular Formula: | C12H17NO3 |
| Molecular Weight: | 223.27 |
| InChI: | InChI=1/C12H17NO3/c1-2-3-8-16-11-6-4-10(5-7-11)9-12(14)13-15/h4-7,15H,2-3,8-9H2,1H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 161 - 162 |
| Density: | 1.12g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.53 |
| Solubility: | Insoluble |
| Appearance: | Acicular crystal |
| Report: |
EPA Genetic Toxicology Program. |
| Usage: | Used for the treatment of skin inflammations. |
| Safety Data | |
 |
|
