| Identification | |
| Name: | 1,3-Dithiolo[4,5-b]quinoxalin-2-one,6-methyl- |
| Synonyms: | Carbonicacid, dithio-, cyclic S,S-(6-methyl-2,3-quinoxalinediyl) ester (6CI,8CI);Carbonic acid, dithio-, cyclic S,S-ester with 6-methyl-2,3-quinoxalinedithiol(7CI); 6-Methyl-1,3-dithiolo[4,5-b]quinoxalin-2-one;6-Methyl-2,3-quinoxalinedithiol cyclic S,S-dithiocarbonate;6-Methyl-2-oxo-1,3-dithio[4,5-b]quinoxaline; BAY 36205; Bayer 36205; Bayer4964; Cetactaelate; Chinomethionat; Daisonet XL 21; Daisonet XL 21S; Forstan;MQD; Morestan; Morestan 2; Morestane; NSC 379587; Oxythioquinox;Quinomethionate; XL 21S |
| CAS: | 2439-01-2 |
| EINECS: | 219-455-3 |
| Molecular Formula: | C10H6 N2 O S2 |
| Molecular Weight: | 234.3 |
| InChI: | InChI=1/C10H6N2OS2/c1-5-2-3-6-7(4-5)12-9-8(11-6)14-10(13)15-9/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Melting Point: | 171 deg C |
| Density: | 1.553g/cm3 |
| Refractive index: | 1.8 |
| Solubility: | Solubility (g/L at 20 deg C) in: toluene, 25; dichloromethane, 40; hexane, 1.8; isopropanol, 0.9; cyclohexanone, 18; dimethylformamide, 10; petroleum oils, 4 In water, 1 mg/L at 20 deg C |
| Storage Temperature: | 0-6°C |
| Color: | Yellow crystals from benzene |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
