| Identification |
| Name: | Nonivamide |
| Synonyms: | pelargonic acid vanillylamide; N-Vanillylnonanamide (Synthetic Capsaicin) = N-[94-hydroxy-3-methoxyphenyl)methyl]nonanamide; Capsaicinsynthesispelargonylvanillylamide); 95%; Capsaicin (synthesis)(=n-Pelargonylvanillylamide); Nonylic Acid Vanillylamide (Nonivamide); nonivamide capsaicine; |
| CAS: | 2444-46-4 |
| EINECS: | 219-484-1 |
| Molecular Formula: | C17H27NO3 |
| Molecular Weight: | 293.4 |
| InChI: | InChI=1/C17H27NO3/c1-3-4-5-6-7-8-9-17(20)18-13-14-10-11-15(19)16(12-14)21-2/h10-12,19H,3-9,13H2,1-2H3,(H,18,20) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Density: | 1.037 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.513 |
| Solubility: | methanol: 100 mg/mL, clear to slightly hazy |
| Appearance: | white to brown powder |
| Color: | white to off-white |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
