| Identification | ||
| Name: | 1,3,5-Triglycidyl Isocyanurate | |
| Synonyms: | Triglycidyl isocyanurate; Isocyanuric acid Triglycidylester; Triglgycidyl Isocyanurate; TGIC; 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,1,3,5-tris(oxiranylmethyl)-; 1,3,5-triglycidylisocyanuricacid; 1,3,5-triglycidyl-s-triazinetrione; 1,3,5-truglycidyl-s-triazinetrione; 3,5-Triazine-2,4,6(1H,3H,5H)-trione,1,3,5-tris(oxiranylmethyl)-1; 5-triazine-2,4,6(1h,3h,5h)-trione,1,3,5-tris(oxiranemethyl)-3; 5-triazine-2,4,6(1h,3h,5h)-trione,1,3,5-tris(oxiranylmethyl)-3; 6(1h,3h,5h)-trione,1,3,5-tris(2,3-epoxypropyl)-s-triazine-4 | |
| CAS: | 2451-62-9 | |
| EINECS: | 219-514-3 | |
| Molecular Formula: | C12H15N3O6 | |
| Molecular Weight: | 297.27 | |
| InChI: | InChI=1/C12H15N3O6/c16-10-13(1-7-4-19-7)11(17)15(3-9-6-21-9)12(18)14(10)2-8-5-20-8/h7-9H,1-6H2 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 25kgs | |
| Flash Point: | 170 C | |
| Density: | 1.625g/cm3 | |
| Stability: | No data. | |
| Refractive index: | 1.635 | |
| Water Solubility: | <0.1 g/100 mL at 20 ºC | |
| Solubility: | 8.7 g/l | |
| Appearance: | White crystalline powder | |
| Packinggroup: | III | |
| Flash Point: | 170 C | |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. | |
| Color: | White powder or granule | |
| Usage: | TGIC is widely used as a cross-linking agent or curing agent in powder coating industry, It is used also in the printed circuit board industry, electrical insulation and as a stabilizer in plastic industry. Typical applications of polyester TGIC powder coatings are where sharp edges and corners exist such as on automotive wheels, air conditioners, lawn furniture, and air conditioner cabinets. | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
|
|
 |
||
