Identification |
Name: | 2,6-Piperazinedione,4,4'-[(1S)-1-methyl-1,2-ethanediyl]bis- |
Synonyms: | 2,6-Piperazinedione,4,4'-(1-methyl-1,2-ethanediyl)bis-, (S)-;2,6-Piperazinedione, 4,4'-propylenedi-,(+)- (8CI);(S)-(+)-1,2-Bis(3,5-dioxopiperazin-1-yl)propane;ADR 529;ICRF187;NSC 169780;Savene;Totect;Zinecard; |
CAS: | 24584-09-6 |
EINECS: | 244-379-2 |
Molecular Formula: | C11H16N4O4 |
Molecular Weight: | 268.27 |
InChI: | InChI=1/C11H16N4O4/c1-7(15-5-10(18)13-11(19)6-15)2-14-3-8(16)12-9(17)4-14/h7H,2-6H2,1H3,(H,12,16,17)(H,13,18,19)/t7-/m0/s1 |
Molecular Structure: |
|
Properties |
Density: | 1.333 g/cm3 |
Refractive index: | 1.539 |
Solubility: | Slightly soluble in methanol and ethanol. Insoluble in non polar organic solvents. Solubility (mg/mL): 35-43 0.1 N HCl, 25-34 0.1 N NaOH, 6.7-10 0.1 M citrate buffer (pH 4), 8.7-13 0.1 M borate buffer (pH 9) In water, 10-12 mg/mL at 25 deg C |
Biological Activity: | Topoisomerase II inhibitor and intracellular ion chelator. Bridges and stabilizes an interface between two ATPase promoters to inhibit topoisomerase II activity. Cardioprotective when co-administered with doxorubicin; decreases formation of reactive oxygen species (ROS) and activates the PI3K/Akt survival pathway. |
Color: | Crystals from aqueous methanol/ether Whitish crystalline powder |
Safety Data |
|
|