| Identification | |
| Name: | 2-[(1-Naphthyloxy)methyl]oxirane |
| Synonyms: | Naphthalene,1-(2,3-epoxypropoxy)- (7CI,8CI);Oxirane, [(1-naphthalenyloxy)methyl]- (9CI);Propane, 1,2-epoxy-3-(1-naphthyloxy)- (6CI);(1-Naphthoxymethyl)oxirane;(1-Naphthyloxymethyl)oxirane;1,2-Epoxy-3-(1-naphthoxy)propane;1,2-Epoxy-3-(a-naphthoxy)propane;1-(1-Naphthoxy)-2,3-epoxypropane;1-(1-Naphthyloxy)-2,3-epoxypropane;1-(2,3-Epoxypropoxy)naphthalene;1-(Glycidyloxy)naphthalene;1-(a-Naphthoxy)-2,3-epoxypropane;1-Naphthalenyloxymethyloxirane;1-Naphtholglycidyl ether;1-Naphthyl glycidyl ether;2,3-Epoxypropyl 1-naphthyl ether;Glycidyl 1-naphthyl ether;2-[[(Naphthalen-1-yl)oxy]methyl]oxirane;3-(1-Naphthyloxy)-1,2-epoxypropane;3-(1-Naphthyloxy)propylene oxide;NSC 632;a-Naphthyl glycidyl ether; |
| CAS: | 2461-42-9 |
| EINECS: | 219-555-7 |
| Molecular Formula: | C13H12O2 |
| Molecular Weight: | 200.23 |
| InChI: | InChI=1/C13H12O2/c1-2-6-12-10(4-1)5-3-7-13(12)15-9-11-8-14-11/h1-7,11H,8-9H2 |
| Molecular Structure: | ![(C13H12O2) Naphthalene,1-(2,3-epoxypropoxy)- (7CI,8CI);Oxirane, [(1-naphthalenyloxy)methyl]- (9CI);Propane, 1,2...](https://img.guidechem.com/casimg/2461-42-9.gif) |
| Properties | |
| Flash Point: | 152 ºC |
| Boiling Point: | 338.6 ºC at 760 mmHg |
| Density: | 1.192 g/cm3 |
| Refractive index: | 1.628 |
| Appearance: | Light purple oil |
| Specification: | Light Purple Oil usageEng:Used in the preparation of Naftopidil (N213500). |
| Flash Point: | 152 ºC |
| Storage Temperature: | Refrigerator |
| Usage: | Used in the preparation of Naftopidil (N213500). |
| Safety Data | |
 |
|
