| Identification | |
| Name: | Oxirane,2,2'-[[1,1'-biphenyl]-4,4'-diylbis(oxymethylene)]bis- |
| Synonyms: | Biphenyl,4,4'-bis(2,3-epoxypropoxy)- (7CI,8CI); 4,4'-Biphenyldiol diglycidyl ether;4,4'-Bis(2,3-epoxypropoxy)biphenyl; 4,4'-Bisglycidyloxybiphenyl;4,4'-Dihydroxybiphenyl diglycidyl ether; Biphenyl-4,4'-diglycidyl ether;p,p'-Bisphenol diglycidyl ether; p-(2,3-Epoxypropoxy)diphenyl |
| CAS: | 2461-46-3 |
| EINECS: | 219-556-2 |
| Molecular Formula: | C18H18 O4 |
| Molecular Weight: | 298.33312 |
| InChI: | InChI=1/C18H18O4/c1-5-15(19-9-17-11-21-17)6-2-13(1)14-3-7-16(8-4-14)20-10-18-12-22-18/h1-8,17-18H,9-12H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 171.5°C |
| Boiling Point: | 473.6°Cat760mmHg |
| Density: | 1.226g/cm3 |
| Refractive index: | 1.587 |
| Specification: |
4,4'-Bis(2,3-epoxypropoxy)biphenyl (CAS No.2461-46-3), its synonyms are Diglycidylether of 4,4'-biphenol ; Polymers of 4,4'-dihydroxy-1,1-biphenyl with (chloromethyl)oxirane ; 2,2'-[(1,1'-Biphenyl)-4,4'-diyl]bis(oxymethylene)bisoxirane ; 3,3'-[Biphenyl-4,4'-diylbisoxy]bis(1,2-epoxypropane) ; 4,4'-Bis[(oxirane-2-yl)methoxy]-1,1'-biphenyl . |
| Flash Point: | 171.5°C |
| Safety Data | |
 |
|
