| Identification | |
| Name: | 1H-Inden-1-one,2,3-dihydro-4-methyl- |
| Synonyms: | 1-Indanone,4-methyl- (6CI,7CI,8CI);4-Methyl-1-indanone;4-methyl-2,3-dihydro-1H-inden-1-one;4-methylindan-1-one;4-Methyl-indanone; |
| CAS: | 24644-78-8 |
| Molecular Formula: | C10H10O |
| Molecular Weight: | 146.19 |
| InChI: | InChI=1S/C10H10O/c1-7-3-2-4-9-8(7)5-6-10(9)11/h2-4H,5-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.113 g/cm3 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
1H-Inden-1-one,2,3-dihydro-4-methyl- , with CAS number of 24644-78-8, can be called 1H-inden-1-one, 2,3-dihydro-4-methyl- ; 4-Methyl-2,3-dihydro-1H-inden-1-on ; 4-Methyl-2,3-dihydro-1H-inden-1-one ; 4-Methylindan-1-one ; 4-Methyl-1-Indanone ; 24644-78-8 [RN] ; 13930-88-6 [RN] .It is a white to light yellow crystal powder. |
| Safety Data | |
 |
|
