| Identification | |
| Name: | Basic Yellow 2 |
| Synonyms: | 1,1-bis(p-dimethylaminophenyl)methylenimine hydrochloride; 4,4'-bis(dimethylamino)benzhydrylidenimine hydrochloride; 4:4'-bis(dimethylamino)benzophenone-imine hydrochloride; 4,4'-(Imidocarbonyl)bis(N,N-dimethylaniline) monohydrochloride; adc auramine o; aizen auramine; aizen auramine oh; auramine 0-100; Auramine O, biological stain; auramine a1; auramine chloride; auramine fa; auramine fwa; Auramine hydrochloride; auramine ii; auramine lake yellow o; auramine n; Auramine O; auramine on; auramine oo; auramine ooo; auramine os; auramine sp; auramine yellow; calcozine yellow ox; Canary Yellow; C.I. 41000; C.I. basic yellow 2; C.I. basic yellow 2, monohydrochloride; mitsui auramine o; Pyoctanunum aureum; Pyoktanin Yellow; Basic Flavine O; C.I.Basic Yellow 2 |
| CAS: | 2465-27-2 |
| EINECS: | 219-567-2 |
| Molecular Formula: | C17H21N3?HCl |
| Molecular Weight: | 303.83 |
| InChI: | InChI=1/C17H21N3.ClH/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4;/h5-12,18H,1-4H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.01g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | slight Stability Stable. Incompatible with strong oxidizing agents. Toxicology Human carcinogen. Toxicity data (The meaning of any toxicological abbreviations w |
| Solubility: | slight
|
| Appearance: | yellow powder |
| Specification: |
?Auramine O ,its CAS NO. is 2465-27-2,the synonyms is (Tetramethyldiamino)diphenylketoimine hydrochloride ; 1,1-Bis(p-dimethylaminophenyl)methylenimine hydrochloride ; 4,4'-(Imidocarbonyl)bis(N,N-dimethylamine), monohydrochloride ; 4,4'-Bis(dimethylamino)-benzhydrylidenimine hydrochloride ; Adc Auramine O ; Aizen Auramine Conc. SFA ; Aizen auramine ; Aizen auramine OH ; Aniline, 4,4'-(imidocarbonyl)bis(N,N-dimethyl-, |
| Storage Temperature: | Store at RT. |
| Color: | Yellow powder |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
