| Identification | |
| Name: | 2-Isobutyl-3-methoxypyrazine |
| Synonyms: | 2-Methoxy-3-isobutylpyrazine |
| CAS: | 24683-00-9 |
| EINECS: | 246-402-1 |
| Molecular Formula: | C9H14N2O |
| Molecular Weight: | 166.22 |
| InChI: | InChI=1/C9H14N2O/c1-7(2)6-8-9(12-3)11-5-4-10-8/h4-5,7H,6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1230 3/PG 2 |
| Melting Point: | 107 |
| Density: | 1g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4912-1.4932 |
| Appearance: | Clear colourless liquid |
| Specification: |
?2-Methoxy-3-isobutyl pyrazine? , its cas register number is 24683-00-9. It also can be called?3-Isobutyl-2-methoxypyrazine ; 2-Methoxy-3-(2-methylpropyl)pyrazine ; Pyrazine, 2-methoxy-3-(2-methylpropyl)- ; 2-Methoxy-3-isobutylpyrazine ; 2-Isobutyl-3-methoxypyrazine ; Pyrazine, 2-isobutyl-3-methoxy- ; 2-iso-butyl-3-methoxypyrazine , can be used as daily use and?food flavor. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
