| Identification |
| Name: | Ethanamine,2-(4-bromophenoxy)-N,N-dimethyl- |
| Synonyms: | 1-Bromo-4-[2-(dimethylamino)ethoxy]benzene;2-(p-Bromophenoxy)-N,N-dimethylethylamine;4-(2-Dimethylaminoethoxy)bromobenzene;N,N-dimethyl-2-(p-bromophenoxy)ethylamine;N-[2-(4-Bromophenoxy)ethyl]-N,N-dimethylamine;Ethylamine,2-(p-bromophenoxy)-N,N-dimethyl- (7CI);4-(2-Dimethylaminoethoxy)phenyl bromide;4-(N,N-Dimethylaminoethoxy)phenyl bromide;4-Bromophenyl 2-(dimethylamino)ethylether; |
| CAS: | 2474-07-9 |
| Molecular Formula: | C10H14BrNO |
| Molecular Weight: | 244.13 |
| InChI: | InChI=1/C10H14BrNO/c1-12(2)7-8-13-10-5-3-9(11)4-6-10/h3-6H,7-8H2,1-2H3 |
| Molecular Structure: |
![(C10H14BrNO) 1-Bromo-4-[2-(dimethylamino)ethoxy]benzene;2-(p-Bromophenoxy)-N,N-dimethylethylamine;4-(2-Dimethylam...](https://img1.guidechem.com/chem/e/dict/108/2474-07-9.jpg) |
| Properties |
| Flash Point: | 127.2°C |
| Boiling Point: | 286.7°C at 760 mmHg |
| Density: | 1.309g/cm3 |
| Refractive index: | 1.537 |
| Flash Point: | 127.2°C |
| Usage: | An intermediate for the synthesis of Tamoxifen. |
| Safety Data |
| Hazard Symbols |
C: Corrosive
|
| |
 |