| Identification |
| Name: | 3-Cyanobenzaldehyde |
| Synonyms: | 3-Formylbenzonitrile; m-Cyanobenzaldehyde |
| CAS: | 24964-64-5 |
| EINECS: | 246-549-1 |
| Molecular Formula: | C8H5NO |
| Molecular Weight: | 131.13 |
| InChI: | InChI=1/C8H5NO/c9-5-7-2-1-3-8(4-7)6-10/h1-4,6H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3439 |
| Density: | 1.15g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.552 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | White to light yellow powder. |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
