| Identification | |
| Name: | 3-Piperidinecarboxylicacid, (3R)- |
| Synonyms: | 3-Piperidinecarboxylicacid, (R)-;(-)-Nipecotic acid;(R)-3-Piperidinecarboxylic acid;(R)-Nipecotic acid;L-(-)-Nipecotic acid;L-Nipecotic acid;Nipecotic acid, (R)-(-)- (8CI); |
| CAS: | 25137-00-2 |
| Molecular Formula: | C6H11NO2 |
| Molecular Weight: | 129.16 |
| InChI: | InChI=1/C6H11NO2/c8-6(9)5-2-1-3-7-4-5/h5,7H,1-4H2,(H,8,9)/t5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 265.8°Cat760mmHg |
| Boiling Point: | 265.8°Cat760mmHg |
| Density: | 1.125g/cm3 |
| Refractive index: | -4.5 ° (C=5, H2O) |
| Alpha: | -5 º (C=1, H2O) |
| Specification: |
(R)-(-)-Nipecotic acid ,its cas register number is 25137-00-2. It also can be called 3-Piperidinecarboxylic acid, (3R)- ; R-Nipecotic acid and (3R)-piperidine-3-carboxylic acid . |
| Flash Point: | 265.8°Cat760mmHg |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
