| Identification |
| Name: | 2-Thiazolamine,4-(3,4-dichlorophenyl)-5-(4-pyridinyl)- |
| Synonyms: | CGH 2466 |
| CAS: | 252198-68-8 |
| Molecular Formula: | C14H9 Cl2 N3 S |
| Molecular Weight: | 322.21236 |
| InChI: | InChI=1/C14H9Cl2N3S/c15-10-2-1-9(7-11(10)16)12-13(20-14(17)19-12)8-3-5-18-6-4-8/h1-7H,(H2,17,19) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 244.4°C |
| Boiling Point: | 480.5°Cat760mmHg |
| Density: | 1.45g/cm3 |
| Refractive index: | 1.68 |
| Biological Activity: | Adenosine A 1 , A 2B and A 3 receptor antagonist (IC 50 values are 19, 21, and 80 nM respectively). Also inhibits p38 MAPK (IC 50 = 187-400 nM) and phosphodiesterase type 4D (IC 50 = 22 nM). Displays potent anti-inflammatory effects in vitro and in vivo . Potentially useful for asthma and chronic obstructive pulmonary disease (COPD) research. |
| Flash Point: | 244.4°C |
| Safety Data |
| |
 |