| Identification |
| Name: | 9H-Fluorene, 9-methyl- |
| Synonyms: | Fluorene,9-methyl- (6CI,7CI,8CI); 9-Methyl-9H-fluorene; 9-Methylfluorene; NSC 10161 |
| CAS: | 2523-37-7 |
| EINECS: | 219-750-7 |
| Molecular Formula: | C14H12 |
| Molecular Weight: | 180.26 |
| InChI: | InChI=1/C14H12/c1-10-11-6-2-4-8-13(11)14-9-5-3-7-12(10)14/h2-10H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 46 - 47 C |
| Flash Point: | 137.5°C |
| Boiling Point: | 299.2°Cat760mmHg |
| Density: | 1.07g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.611 |
| Water Solubility: | n/a Stability Stable. Combustible. Incompatible with strong oxidizing agents. Toxicology No toxicological data available. Toxicity data (The meaning of any toxic |
| Solubility: | n/a |
| Appearance: | solid |
| Flash Point: | 137.5°C |
| Safety Data |
| |
 |
