| Identification |
| Name: | Ethyl picolinate |
| Synonyms: | Ethyl picolinate,Ethyl pyridine-2-carboxylate; Ethyl pyridine-2-carboxylate~Picolinic acid ethyl ester; alpha-Picolinic acid ethyl ester; 2-(Ethoxycarbonyl)pyridine; ETHYL PYRIDINE-2-CARBOXYLATE; ETHYL 2-PYRIDINECARBOXYLATE; ETHYL 2-PICOLINATE; 2-PYRIDINECARBOXYLIC ACID ETHYL ESTER; 2-PICOLINIC ACID, ETHYL ESTER; RARECHEM AL BI 0182 |
| CAS: | 2524-52-9 |
| EINECS: | 219-758-0 |
| Molecular Formula: | C8H9NO2 |
| Molecular Weight: | 151.16 |
| InChI: | InChI=1/C8H9NO2/c1-2-11-8(10)7-5-3-4-6-9-7/h3-6H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 200kgs |
| Density: | 1.119 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.509-1.511 |
| Water Solubility: | miscible |
| Solubility: | miscible
< |
| Appearance: | clear to slightly yellow liquid |
| HS Code: | 29333999 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
