Identification |
Name: | Heptanoyl chloride |
Synonyms: | Oenanthic chloride; n-Heptanoyl chloride; Enanthic chloride; anthic chloride; |
CAS: | 2528-61-2 |
EINECS: | 219-775-3 |
Molecular Formula: | C7H13ClO |
Molecular Weight: | 148.63 |
InChI: | InChI=1/C7H13ClO/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 2920 |
Density: | 0.96 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.4295-1.4315 |
Water Solubility: | REACTS |
Solubility: | REACTS with water |
Appearance: | COLORLESS LIQUID |
Packinggroup: | II |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
|