| Identification |
| Name: | Heptanoyl chloride |
| Synonyms: | Oenanthic chloride; n-Heptanoyl chloride; Enanthic chloride; anthic chloride; |
| CAS: | 2528-61-2 |
| EINECS: | 219-775-3 |
| Molecular Formula: | C7H13ClO |
| Molecular Weight: | 148.63 |
| InChI: | InChI=1/C7H13ClO/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2920 |
| Density: | 0.96 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4295-1.4315 |
| Water Solubility: | REACTS |
| Solubility: | REACTS with water |
| Appearance: | COLORLESS LIQUID |
| Packinggroup: | II |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
