| Identification | |
| Name: | Benzene,bis(1-methylethyl)- |
| Synonyms: | Benzene,diisopropyl- (8CI); Bis(1-methylethyl)benzene; Bis(isopropyl)benzene;Diisopropylbenzene |
| CAS: | 25321-09-9 |
| EINECS: | 246-835-6 |
| Molecular Formula: | C12H18 |
| Molecular Weight: | 162.2742 |
| InChI: | InChI=1/3C12H18/c1-9(2)11-5-7-12(8-6-11)10(3)4;1-9(2)11-6-5-7-12(8-11)10(3)4;1-9(2)11-7-5-6-8-12(11)10(3)4/h3*5-10H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3082 |
| Density: | 0.85 |
| Refractive index: | 1.488-1.491 |
| Solubility: | Sol in all proportions of alcohol, ether, acetone and benzene. |
| Specification: |
Diisopropylbenzene ,its CAS NO. is 25321-09-9,the synonyms is Bis(1-methylethyl)-benzen ; Bis(1-methylethyl)benzene ; Bis(1-methylethyl)-benzene ; Diisopropyl-benzen ; Diisopropylbenzene(allisomers) ; Diisopropylbenzene,2:1mixtureofm-andp-isomer ; Diisopropylbenzene ; Diisopropylbenzene (mixture) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Color: | Clear, colorless liquid |
| Safety Data | |
 |
|
