| Identification |
| Name: | Isodecanol |
| Synonyms: | Isodecylalcohol (6CI,7CI,8CI); Exxal 10 |
| CAS: | 25339-17-7 |
| EINECS: | 246-869-1 |
| Molecular Formula: | C10H22 O |
| Molecular Weight: | 158.28 |
| InChI: | InChI=1/C10H22O/c1-10(2)8-6-4-3-5-7-9-11/h10-11H,3-9H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3082 |
| Melting Point: | 7 |
| Density: | 0.826g/cm3 |
| Stability: | No data. |
| Refractive index: | n20/D 1.440 |
| Solubility: | Insoluble |
| Appearance: | Colorless liquid with a mild alcohol odor. |
| Packinggroup: | III |
| Storage Temperature: | Materials which are toxic as stored or which can decompose into toxic components.Should be stored in a cool well ventilated place, out of the direct rays of the sun, away from areas of high fire hazard, and should be periodically inspected. Incompatible materials should be isolated. |
| Color: | Colorless liquid |
| Usage: | Chemical intermediate for the plasticizer, diisodecyl phthalate, ingredient in synthetic lubricants, agent in uranium refining, specialty solvent, antifoaming agent in textile processing. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
