| Identification |
| Name: | 1,3-Propanediol,2-phenyl-, 1,3-dicarbamate |
| Synonyms: | 1,3-Propanediol,2-phenyl-, dicarbamate (8CI,9CI);Carbamic acid, 2-phenyltrimethylene ester(6CI,7CI);1,3-Bis(carbamoyloxy)-2-phenylpropane;ADD 03055;Felbamyl;Felbatol;Taloxa;W 554;2-Phenyl-1,3-propanediol dicarbamate; |
| CAS: | 25451-15-4 |
| EINECS: | 247-001-4 |
| Molecular Formula: | C11H14N2O4 |
| Molecular Weight: | 238.24 |
| InChI: | InChI=1/C11H14N2O4/c12-10(14)16-6-9(7-17-11(13)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 148-150ºC |
| Density: | 1.275 g/cm3 |
| Refractive index: | 1.558 |
| Water Solubility: | soluble in alcohol |
| Solubility: | soluble in alcohol |
| Appearance: | white crystalline powder |
| Biological Activity: | Anticonvulsant, acting as an antagonist at the NMDA-associated glycine binding site. |
| Color: | White powder |
| Usage: | Antiepileptic, structurally similar to meprobamate |
| Safety Data |
| Hazard Symbols |
|
| |
 |
