| Identification | |
| Name: | Iminostilbene |
| Synonyms: | 5H-Dibenz[b,f]azepine; IMINOSTILBENE (BROMINE FREE); IMINOSTILBENE (NON-BROMINE FREE2,3,6,7-Dibenzazepine; 5-Azadibenzo(a,e)cycloheptatriene; Dibenz(b,f)azepine; Stilbene, 2,2'-imino-; (-)-O-FORMYL-D-MANDELOYL CHLORIDE; R-FMOC |
| CAS: | 256-96-2 |
| EINECS: | 205-970-0 |
| Molecular Formula: | C14H11N |
| Molecular Weight: | 193.25 |
| InChI: | InChI=1/C14H11N/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)15-13/h1-10,15H |
| Molecular Structure: | ![(C14H11N) 5H-Dibenz[b,f]azepine; IMINOSTILBENE (BROMINE FREE); IMINOSTILBENE (NON-BROMINE FREE2,3,6,7-Dibenzaz...](https://img.guidechem.com/casimg/256-96-2.gif) |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.116 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.523(lit.) |
| Solubility: | Insoluble |
| Appearance: | yellow to brown powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry area away from incompatible substances. |
| Color: | yellow to orange |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
