| Identification |
| Name: | Cyclododecane,hexabromo- |
| Synonyms: | BRE 5300;Bromkal 73-6CD;CD 75;CD 75P;FR 104;FR 104 (fireproofing agent);FR 1206ILM;FR-CD;HBCD-LM;HBCD-LMS;HBCD-SP 75;HP 900G;Hexabromocyclododecane;Myflam11645;Nicca Fi-None CG 1;NiccaFi-None TS 88;Pyroguard F 800;Pyroguard SR 103;Pyroguard SR 103A;Pyrovatex 3887;SP 75;Safron 5261;Saytex HBCD;SaytexHBCD-LM;Saytex HBCD-SF;Saytex HP 900;Saytex HP 900G;YM 88; |
| CAS: | 25637-99-4 |
| EINECS: | 247-148-4 |
| Molecular Formula: | C12H18Br6 |
| Molecular Weight: | 641.69532 |
| InChI: | InChI=1S/C12H18Br6/c13-7-1-8(14)3-10(16)5-12(18)6-11(17)4-9(15)2-7/h7-12H,1-6H2 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 175-185 oC |
| Density: | 2.145 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.607 |
| Water Solubility: | at 25c(g/100g solvent) in water |
| Solubility: | at 25c(g/100g solvent) in water |
| Appearance: | White or off-white powder |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| |
 |
