| Identification | |
| Name: | Acetamide,N-(4-bromophenyl)-2-chloro- |
| Synonyms: | Acetanilide,4'-bromo-2-chloro- (6CI,7CI,8CI);2-Chloro-4'-bromoacetanilide;2-Chloro-N-(p-bromophenyl)acetamide;N-(4-Bromophenyl)-2-chloroacetamide;N-(4-Bromophenyl)chloroacetamide;N-(Chloroacetyl)-4-bromoaniline;N-Chloroacetyl-p-bromoaniline;NSC 220248;p-Bromo-2-chloroacetanilide; |
| CAS: | 2564-02-5 |
| Molecular Formula: | C8H7BrClNO |
| Molecular Weight: | 248.5 |
| InChI: | InChI=1/C8H7BrClNO/c9-6-1-3-7(4-2-6)11-8(12)5-10/h1-4H,5H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 180-184 °C (dec.)(lit.) |
| Flash Point: | 187.4°C |
| Boiling Point: | 386.3°Cat760mmHg |
| Density: | 1.655g/cm3 |
| Refractive index: | 1.625 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 187.4°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
