| Identification | |
| Name: | 6-Octen-4-yn-2-ol,1-(dimethylamino)-6-ethyl-, hydrochloride (1:1) |
| Synonyms: | 6-Octen-4-yn-2-ol,1-(dimethylamino)-6-ethyl-, hydrochloride (8CI,9CI); 1-Dimethylamino-6-ethyloct-6-en-4-yn-2-olhydrochloride |
| CAS: | 25708-11-6 |
| Molecular Formula: | C12H21 N O . Cl H |
| Molecular Weight: | 231.80 |
| InChI: | InChI=1/C12H21NO.ClH/c1-5-11(2)8-6-7-9-12(14)10-13(3)4;/h8,12,14H,5,9-10H2,1-4H3;1H/b11-8-; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 127.8°C |
| Boiling Point: | 304.4°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
The extinguishing agent of 1-Dimethylamino-6-ethyloctane-6-yn-4-ol-2 hydrochloride (CAS No.25708-11-6) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 127.8°C |
| Safety Data | |
 |
|
