| Identification | |
| Name: | Alanine,3-(methylseleno)- |
| Synonyms: | Alanine,3-(methylselenyl)- (6CI,7CI,8CI); DL-Se-methylselenocysteine;Methylselenocysteine; NSC 319053; Selenocysteine, Se-methyl- |
| CAS: | 2574-71-2 |
| Molecular Formula: | C4H9 N O2 Se |
| Molecular Weight: | 182.08 |
| InChI: | InChI=1/C4H9NO2Se/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143.7°C |
| Boiling Point: | 314.1°Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. Hygroscopic: absorbs moisture or water from the air. |
| Appearance: | Yellow powder. |
| Specification: |
3-(Methylseleno)alanine , its cas register number is 2574-71-2. It also can be called Se-Methyl-selenocysteine ; Se-methyl-seleno-L-cysteine ; Selenium methyl cysteine ; Selenohomocysteine ; Selenomethylselenocysteine .It is a yellow powder. |
| Flash Point: | 143.7°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Safety Data | |
 |
|
