| Identification |
| Name: | Poly(oxy-1,2-ethanediyl),a-(2-methyl-1-oxo-2-propen-1-yl)-w-[(2-methyl-1-oxo-2-propen-1-yl)oxy]- |
| Synonyms: | Glycols,polyethylene, dimethacrylate (8CI);Poly(oxy-1,2-ethanediyl), a-(2-methyl-1-oxo-2-propenyl)-w-[(2-methyl-1-oxo-2-propenyl)oxy]-(9CI);Methacrylic acid, diester with polyethylene glycol (8CI);A 4EG;BisomerP 10W;Bisomer PEM 200;Blemmer 100;Blemmer PDE 1000;Blemmer PDE 200;BlemmerPDE 400;Blemmer PDE 50R;Blemmer PDE 600;Blemmer PDE 6000;Chemlink 600;Chemlink CL 600;EG 2500;ENT 110;FA 220M;Fimoweld;Graset T 303;Graset T30D;Heneicosaethylene glycol dimethacrylate;Hydrogel;Hydrogel II;HydrogelIV;Hydrogel VI;Light Acrylate P 303;Light Ester 14EG;Light Ester 4EG;LightEster 9EG;Mhoromer D 1120;Mhoromer D 1133;Mhoromer MFM 409;NK 14G;NK 1G;NK 23G;NK 9G;NK Ester 14G;NK Ester 14KG;NK Ester 23G;NK Ester 9G;NewFrontier NF Bisomer PEM 200;Oligoethylene glycol dimethacrylate;PDBE 200;PDE1000;PDE 400;PEG 4000DMA;PEGMA 14G;PEGMA 23G;PEGMA 9G;PU 280;Poly(ethylene oxide) dimethacrylate;Polyethylene glycol dimethacrylate;Polyethylene glycol methacrylate;Polyoxyethylene dimethacrylate;SR 210;SR252;SR 603;Sartomer 210;Sartomer 603;TGM 13; |
| CAS: | 25852-47-5 |
| Molecular Formula: | (C2H4O)nC8H10O3 |
| Molecular Weight: | 198.21576 |
| InChI: | InChI=1S/C10H14O4/c1-7(2)9(11)13-5-6-14-10(12)8(3)4/h1,3,5-6H2,2,4H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 200kgs
|
| Melting Point: | -40 deg C |
| Flash Point: | > 105 C |
| Boiling Point: | > 200 C
|
| Density: | 1.041g/cm3 |
| Stability: | Stable. Incomaptible with strong oxidizing agents. May be sensitive to sunlight. |
| Refractive index: | n20/D 1.467 |
| Water Solubility: | miscible |
| Solubility: | miscible |
| Appearance: | clear
liquid |
| Flash Point: | > 105 C |
| Storage Temperature: | Refrigerator |
| Safety Data |
| Hazard Symbols |
|
| |
 |
