| Identification | |
| Name: | 4-Pyridinamine,2,6-dichloro- |
| Synonyms: | Pyridine,4-amino-2,6-dichloro- (6CI,7CI,8CI);(2,6-Dichloropyridin-4-yl)amine;2,6-Dichloro-4-aminopyridine;2,6-Dichloropyridin-4-amine;NSC 136573; |
| CAS: | 2587-02-2 |
| EINECS: | -0 |
| Molecular Formula: | C5H4Cl2N2 |
| Molecular Weight: | 163.01 |
| InChI: | InChI=1/C5H4Cl2N2/c6-4-1-3(8)2-5(7)9-4/h1-2H,(H2,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.497 g/cm3 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | white crystals |
| Specification: | Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
