| Identification |
| Name: | 1,4-Naphthalenedione,2-methyl-3-[(phenylmethyl)thio]- |
| Synonyms: | 1,4-Naphthoquinone,2-(benzylthio)-3-methyl- (7CI,8CI); NSC 66457 |
| CAS: | 2593-59-1 |
| Molecular Formula: | C18H14 O2 S |
| Molecular Weight: | 294.3676 |
| InChI: | InChI=1/C18H14O2S/c1-12-16(19)14-9-5-6-10-15(14)17(20)18(12)21-11-13-7-3-2-4-8-13/h2-10H,11H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 197.2°C |
| Boiling Point: | 455.8°Cat760mmHg |
| Density: | 1.27g/cm3 |
| Refractive index: | 1.658 |
| Flash Point: | 197.2°C |
| Safety Data |
| |
 |