| Identification | |
| Name: | 2-Propenoic acid,polymers,homopolymer,calcium salt |
| Synonyms: | Polyacrylic acid calcium salt |
| CAS: | 25987-55-7 |
| Molecular Formula: | C3H4O2 |
| Molecular Weight: | 72.06266 |
| InChI: | InChI=1S/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 12.5 deg C |
| Flash Point: | 61.6°C |
| Boiling Point: | 141°Cat760mmHg |
| Density: | 1.063g/cm3 |
| Solubility: | Miscible with alcohol, and ether Miscible with ethanol, ethyl ether; soluble in acetone, benzene, carbon tetrachloride Miscible with chloroform Miscible with water /1X10+6 mg/L/ at 25 deg C |
| Flash Point: | 61.6°C |
| Color: | Volatile liquid Colorless liquid Colorless liquid or solid (below 55 degrees F) |
| Safety Data | |
 |
|
