| Identification | |
| Name: | 3,5-Dihydroxybenzaldehyde |
| Synonyms: | 3,5-Dihydoxybenzal dehyde;3,5-Dihydroxy Benzaldehyde; |
| CAS: | 26153-38-8 |
| EINECS: | 247-479-4 |
| Molecular Formula: | C7H6O3 |
| Molecular Weight: | 138.12 |
| InChI: | InChI=1/C7H6O3/c8-4-5-1-6(9)3-7(10)2-5/h1-4,9-10H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.409g/cm3 |
| Refractive index: | 1.674 |
| Appearance: | White to tan to grey crystalline powder |
| Specification: |
?3,5-Dihydroxybenzaldehyde , its cas register number is 26153-38-8. It also can be called Benzaldehyde, 3,5-dihydroxy- ; and .alpha.-Resorcylic aldehyde . It should be stored in cool, dry place in tightly closed containers. |
| Sensitive: | Air Sensitive |
| Safety Data | |
 |
|
