| Identification | |
| Name: | 2-(6-METHOXY-2-NAPHTHYL)PROPANOIC ACID |
| Synonyms: | AURORA KA-6750;2-(6-METHOXY-2-NAPHTHYL)PROPANOIC ACID;rac-(2R*)-2-(6-Methoxy-2-naphtyl)propanoic acid; |
| CAS: | 26159-31-9 |
| EINECS: | 247-485-7 |
| Molecular Formula: | C14H14O3 |
| Molecular Weight: | 230.26 |
| InChI: | InChI=1/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 154.5°C |
| Boiling Point: | 403.9°C at 760 mmHg |
| Density: | 1.197g/cm3 |
| Refractive index: | 1.608 |
| Solubility: | Slightly soluble in ether; soluble in methanol, chloroform Soluble in 25 parts ethanol (96%), 20 parts methanol, 15 parts chloroform, 40 parts ether. Practically insoluble in water Practically insoluble in water and freely soluble in alcohol. In water, 15.9 mg/L at 25 deg C |
| Flash Point: | 154.5°C |
| Color: | Crystals from acetone-hexane White to off-white crystalline powder White to creamy white, crystalline powder; soluble in water and sparingly soluble in alcohol. /Naproxen sodium/ |
| Safety Data | |
 |
|
