| Identification |
| Name: | 1H-Pyrrole-2-aceticacid, 1-methyl-5-(4-methylbenzoyl)- |
| Synonyms: | Pyrrole-2-aceticacid, 1-methyl-5-p-toluoyl- (8CI); 1-Methyl-5-p-toluoylpyrrole-2-acetic acid;5-[(p-Tolyl)carbonyl]-1-methylpyrrole-2-acetic acid; McN 2559; Tolmetin;Tolmetine |
| CAS: | 26171-23-3 |
| EINECS: | 247-497-2 |
| Molecular Formula: | C15H15 N O3 |
| Molecular Weight: | 257.31 |
| InChI: | InChI=1/C14H13NO3/c1-9-3-5-10(6-4-9)13(16)11-7-8-12(14(17)18)15(11)2/h3-8H,1-2H3,(H,17,18) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 156 ºC |
| Density: | 1.18 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.589 |
| Water Solubility: | 222 MG/L |
| Solubility: | 222 mg/L in water |
| Appearance: | Off-white crystalline power |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | CRYSTALS FROM ACETONITRILE |
| Usage: | Medication. |
| Safety Data |
| |
 |
