| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 6-bromo-, methyl ester |
| Synonyms: | Nicotinicacid, 6-bromo-, methyl ester (8CI); Nicotinic acid, 6-bromo-, methyl esters(5CI); 6-Bromonicotinic acid methyl ester; 6-Bromopyridine-3-carboxylic acidmethyl ester; Methyl 6-bromo-3-pyridinecarboxylate; Methyl 6-bromonicotinate |
| CAS: | 26218-78-0 |
| Molecular Formula: | C7H6 Br N O2 |
| Molecular Weight: | 216.03 |
| InChI: | InChI=1/C7H6BrNO2/c1-11-7(10)5-2-3-6(8)9-4-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 119-121 |
| Density: | 1.579g/cm3 |
| Refractive index: | 1.554 |
| Specification: |
3-Pyridinecarboxylicacid, 6-bromo-, methyl ester , its cas register number is 26218-78-0. It also can be called ; 6-Bromonicotinate de méthyle ; Methyl 6-bromonicotinate ; Methyl-6-bromnicotinat . The storage environment of 3-Pyridinecarboxylicacid, 6-bromo-, methyl ester (CAS NO.26218-78-0) should be cold. |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
