| Identification | |
| Name: | Acetamide,N-[4-(acetyloxy)phenyl]- |
| Synonyms: | Acetanilide,4'-hydroxy-, acetate (6CI,7CI);Acetanilide, 4'-hydroxy-, acetate (ester)(8CI);4-Acetamidophenyl acetate;4'-Acetoxyacetanilide;Acetaminophen acetate;Diacetamate;N-(4-Acetoxyphenyl)acetamide;N-Acetyl-4-aminophenyl acetate;NSC33893;NSC 6083;O-Acetylparacetamol;p-Acetamidophenyl acetate;p-Acetoxyacetanilide; |
| CAS: | 2623-33-8 |
| EINECS: | 220-077-6 |
| Molecular Formula: | C10H11NO3 |
| Molecular Weight: | 193.2 |
| InChI: | InChI=1/C10H11NO3/c1-7(12)11-9-3-5-10(6-4-9)14-8(2)13/h3-6H,1-2H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 155°C |
| Flash Point: | 181.4°C |
| Boiling Point: | 376.4°Cat760mmHg |
| Density: | 1.206g/cm3 |
| Refractive index: | 1.561 |
| Appearance: | White solid |
| Specification: | White Solid usageEng:A synthetic impurity of Acetaminophen Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 181.4°C |
| Storage Temperature: | Refrigerator |
| Usage: | A synthetic impurity of Acetaminophen |
| Safety Data | |
 |
|
