Identification |
Name: | D-Glycero-D-galacto-Non-2-enonicacid, 4-(acetylamino)-2,6-anhydro-3,4-dideoxy- |
Synonyms: | 4-Acetylamino-Kdn2en, iso-Neu4Ac2en;4-Acetamido-3-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid; |
CAS: | 263155-11-9 |
Molecular Formula: | C11H17NO8 |
Molecular Weight: | 291.254 |
InChI: | InChI=1/C11H17NO8/c1-4(14)12-5-2-7(11(18)19)20-10(8(5)16)9(17)6(15)3-13/h2,5-6,8-10,13,15-17H,3H2,1H3,(H,12,14)(H,18,19)/t5?,6-,8?,9-,10?/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 421.554°C |
Boiling Point: | 773.428°C at 760 mmHg |
Density: | 1.588g/cm3 |
Refractive index: | 1.613 |
Solubility: | Soluble in DMSO and Water |
Appearance: | White solid |
Flash Point: | 421.554°C |
Usage: | A potential inhibitor of virus sialidase. |
Safety Data |
|
|