| Identification |
| Name: | Dodecanoic acid,ethenyl ester, polymer with ethenyl acetate |
| Synonyms: | Lauric acid(dodecanoic acid), vinyl ester, polymer with vinyl acetate (7CI); Lauric acid,vinyl ester, polymer with vinyl acetate (8CI); Acetic acid ethenyl ester,polymer with ethenyl dodecanoate (9CI); Acetic acid vinyl ester, polymer withvinyl laurate (8CI); Vinnapas 50/5VL; Vinnapas B 100/20VL; Vinnapas B 100VL20;Vinnapas B 500/20VL; Vinnapas B 500/40VL; Vinyl acetate-vinyl lauratecopolymer; Vinyl acetate-vinyl laurate polymer; Vinyl laurate-vinyl acetatecopolymer |
| CAS: | 26354-30-3 |
| Molecular Formula: | C14 H26 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C14H26O2.C4H6O2/c1-3-5-6-7-8-9-10-11-12-13-14(15)16-4-2;1-3-6-4(2)5/h4H,2-3,5-13H2,1H3;3H,1H2,2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 100.8°C |
| Boiling Point: | 288.2°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 100.8°C |
| Safety Data |
| |
 |
