| Identification | |
| Name: | Thiourea,N-(4-bromophenyl)- |
| Synonyms: | 4-Bromophenylthiourea;N-(4-Bromophenyl)thiourea;N-p-Bromophenylthiourea;Urea, 1-(p-bromophenyl)-2-thio- (6CI,7CI,8CI);1-(4-Bromophenyl)thiourea;Thiourea,(4-bromophenyl)- (9CI);NSC 3404;NSC 72167;p-Bromophenylthiourea; |
| CAS: | 2646-30-2 |
| EINECS: | -0 |
| Molecular Formula: | C7H7BrN2S |
| Molecular Weight: | 231.116 |
| InChI: | InChI=1/C7H7BrN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 183-184°C |
| Flash Point: | 145.5°C |
| Boiling Point: | 317°Cat760mmHg |
| Density: | 1.728g/cm3 |
| Refractive index: | 1.748 |
| Specification: | Safety Statements:22-36/37-45 22:Do not breathe dust 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 145.5°C |
| Safety Data | |
 |
|
