| Identification | |
| Name: | Benzene,1,3-diisocyanatomethyl- |
| Synonyms: | Isocyanicacid, methyl-m-phenylene ester (8CI);1,3-Diisocyanatomethylbenzene;CosmonateTDI;Diisocyanatotoluene;Methyl-m-phenylene isocyanate;Methylphenyleneisocyanate;TDI;TDI 65;TDI 80;TDI 80/20; |
| CAS: | 26471-62-5 |
| EINECS: | 247-722-4 |
| Molecular Formula: | C9H6N2O2 |
| Molecular Weight: | 174.15 |
| InChI: | InChI=1/C9H6N2O2/c1-7-2-3-8(10-5-12)4-9(7)11-6-13/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2078 |
| Density: | 1.217 |
| Refractive index: | 1.559 |
| Solubility: | Miscible with alcohol (decomposition). Miscible with ether, acetone, benzene, carbon tetrachloride, chlorobenzene, diglycol monomethyl ether, kerosene, olive oil; sol in ethyl acetate. |
| Appearance: | clear colorless to pale yellow liquid |
| Packinggroup: | II |
| Color: | A WATER-WHITE LIQ WHICH TURNS STRAW-COLORED ON STANDING Clear to light yellow liq or crystals Colorless to pale yellow, solid or liquid (above 71 deg F). |
| Safety Data | |
 |
|
