| Identification | |
| Name: | L-Glutamine,N2-[(phenylmethoxy)carbonyl]- |
| Synonyms: | CBZ-L-Glutamine;Z-Gln-OH;Glutamine, N2-carboxy-, N2-benzyl ester,L- (8CI);(Benzyloxycarbonyl)glutamine;N-(Benzyloxycarbonyl)-L-glutamine;N-(Benzyloxycarbonyl)glutamine;N-Carbobenzoxy-L-glutamine;N2-Benzyloxycarbonyl-L-glutamine;NSC 186903; |
| CAS: | 2650-64-8 |
| EINECS: | 220-173-8 |
| Molecular Formula: | C13H16N2O5 |
| Molecular Weight: | 280.28 |
| InChI: | InChI=1/C13H16N2O5/c14-11(16)7-6-10(12(17)18)15-13(19)20-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H2,14,16)(H,15,19)(H,17,18)/t10-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.316g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -7 o (C=2, ETOH) |
| Appearance: | White powder. |
| Specification: | white to off-white powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Safety Data | |
 |
|
