| Identification | |
| Name: | 2-Octyl-2H-isothiazol-3-one |
| Synonyms: | 4-Isothiazolin-3-one,2-octyl- (8CI);2-Octyl-3-isothiazolone;2-Octyl-4-isothiazoline-3-one;2-n-Octyl-3-isothiazolone;2-n-Octyl-4-isothiozolin-3-one;A-DW;Acticide 45;Acticide OTW;Kathon 4200;Kathon 893F;Kathon893T;Kathon LP Preservative;Levanax BS 50;Octhilinone;Pancil;RH893;SD 888;Skane M 8;Zonen 0/100;Zonen O 100; |
| CAS: | 26530-20-1 |
| EINECS: | 247-761-7 |
| Molecular Formula: | C11H19NOS |
| Molecular Weight: | 213.34 |
| InChI: | InChI=1/C11H19NOS/c1-2-3-4-5-6-7-9-12-11(13)8-10-14-12/h8,10H,2-7,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2922 |
| Density: | 1.01-1.05 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.513 |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | Light Yellow Oil |
| Specification: |
?2-Octyl-2H-isothiazol-3-one (CAS NO.26530-20-1) reacts as an isothiocyanate. Reactions with amines, aldehydes, alcohols, alkali metals, ketones, mercaptans, strong oxidizers, hydrides, phenols, and peroxides can cause vigorous releases of heat. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Fungicide. Antimicrobial agent |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
