| Identification | |
| Name: | 3-Pyrazolidinone,4-methyl-1-phenyl- |
| Synonyms: | 1-Phenyl-4-methyl-3-oxopyrazolidine;1-Phenyl-4-methyl-3-pyrazolidinone;4-Methyl-1-phenyl-3-pyrazolidinone;4-Methyl-1-phenyl-3-pyrazolidone;4-Methyl-1-phenyl-4,5-dihydro-1H-pyrazol-3-ol;NSC 96628;Phenidone B; |
| CAS: | 2654-57-1 |
| EINECS: | 220-180-6 |
| Molecular Formula: | C10H12N2O |
| Molecular Weight: | 176.22 |
| InChI: | InChI=1/C10H12N2O/c1-8-7-12(11-10(8)13)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Boiling Point: | 345 |
| Density: | 1.126g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Light sensitive. |
| Refractive index: | 1.552 |
| Solubility: | |
| Appearance: | White to off-white crystals |
| Specification: |
3-Pyrazolidinone,4-methyl-1-phenyl- , its cas register number is 2654-57-1. It also can be called 1-Phenyl-4-methyl-3-pyrazolidone ; 4-Methyl-1-phenyl-3-pyrazolidinone ; AI3-60150 ; NSC 96628 ; Phenidone B . 3-Pyrazolidinone,4-methyl-1-phenyl- (CAS NO.2654-57-1) toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. And it is harmful if swallowed. |
| Packinggroup: | III |
| Storage Temperature: | Dark Room |
| Safety Data | |
| Hazard Symbols | |
 |
|
