| Identification |
| Name: | 2-Propenamide,N,N-diethyl- |
| Synonyms: | Acrylamide,N,N-diethyl- (6CI,7CI,8CI);Acrylic acid diethylamide;DEAA;N,N-Diethyl-2-propenamide;N,N-Diethylacrylamide;NSC 20951; |
| CAS: | 2675-94-7 |
| Molecular Formula: | C7H13NO |
| Molecular Weight: | 127.18422 |
| InChI: | InChI=1S/C7H13NO/c1-4-7(9)8(5-2)6-3/h4H,1,5-6H2,2-3H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -10ºC |
| Density: | 0.885 g/cm3 |
| Refractive index: | 1.441 |
| Water Solubility: | Soluble in water and other ordinary organic solvents (soluble in n-hexane) |
| Solubility: | Soluble in water and other ordinary organic solvents (soluble in n-hexane) |
| Appearance: | Colorless or slight yellow and clear liquid |
| Safety Data |
| |
 |
