| Identification | |
| Name: | Naphtho[1,2-d]thiazole,2-methyl- |
| Synonyms: | 2-Methyl-a-naphthothiazole; 2-Methyl-b-naphthiazole; 2-Methyl-b-naphthothiazole;2-Methylnaphtho[1,2-d]thiazole; NSC 332548 |
| CAS: | 2682-45-3 |
| EINECS: | 220-240-1 |
| Molecular Formula: | C12H9 N S |
| Molecular Weight: | 199.27 |
| InChI: | InChI=1/C12H9NS/c1-8-13-12-10-5-3-2-4-9(10)6-7-11(12)14-8/h2-7H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 174°C |
| Boiling Point: | 168 °C / 5.5mmHg |
| Density: | 1.272g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.741 |
| Appearance: | Off white - dark yellow powder. |
| Specification: |
Naphtho[1,2-d]thiazole,2-methyl- , its cas register number is 2682-45-3. It also can be called 2-Methyl-beta-naphthothiazole ; 2-Methylnaphtho(1,2-d)thiazole .It is a light yellow to beige-brown crystalline powder. |
| Flash Point: | 174°C |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
