| Identification | |
| Name: | Benzene,1,1'-(chloromethylene)bis[4-fluoro- |
| Synonyms: | Methane,chlorobis(p-fluorophenyl)- (8CI);4,4'-Difluorobenzhydryl chloride;4,4'-Difluorodiphenylmethyl chloride;Bis(4-fluorophenyl)methyl chloride;Bis(p-fluorophenyl)methyl chloride;Chlorobis(4-fluorophenyl)methane;Chlorobis(p-fluorophenyl)methane; |
| CAS: | 27064-94-4 |
| EINECS: | 248-201-4 |
| Molecular Formula: | C13H9ClF2 |
| Molecular Weight: | 238.66 |
| InChI: | InChI=1/C13H9ClF2/c14-13(9-1-5-11(15)6-2-9)10-3-7-12(16)8-4-10/h1-8,13H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 2 |
| Density: | 1.25 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.556-1.558 |
| Appearance: | White Microcrystalling Powder or Micro Compacted Powder |
| Specification: |
4,4'-Difluorodiphenylmethylchloride (CAS NO.27064-94-4), its Synonyms are 1,1'-(Chloromethylene)bis(4-fluorobenzene) ; Bis(4-fluorophenyl)chloromethane ; Chlorobis(4-fluorophenyl)methane ; 4,4-Difluorodipenylchloromethane ; Chlorobis(p-fluorophenyl)methane ; 4,4'-Difluorobenzhydrylchloride,98% . It is clear colourless to slightly yellow liquid. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
