| Identification | |
| Name: | 2,3-Benzofuran |
| Synonyms: | Coumarone; Benzo[b]furan, (2,3-Benzofuran; Coumarone); Benzo[b]furan |
| CAS: | 271-89-6 |
| EINECS: | 205-982-6 |
| Molecular Formula: | C8H6O |
| Molecular Weight: | 118.13 |
| InChI: | InChI=1/C8H6O/c1-2-4-8-7(3-1)5-6-9-8/h1-6H |
| Molecular Structure: | ![(C8H6O) Coumarone; Benzo[b]furan, (2,3-Benzofuran; Coumarone); Benzo[b]furan](https://img.guidechem.com/casimg/271-89-6.gif) |
| Properties | |
| Transport: | UN 1993 |
| Melting Point: | -18 C |
| Density: | 1.07 |
| Refractive index: | 1.5655-1.5675 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | clear to slightly greenish liquid |
| Specification: |
The extinguishing agent of?2,3-Benzofuran (CAS No. 271-89-6) are dry powder, foam, sand, carbon dioxide, water mist. |
| Packinggroup: | III |
| HS Code: | 29329900 |
| Color: | Not solid @ -18 deg C; oil Colorless, oily liquid |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
