| Identification | |
| Name: | Arsenous acid, calciumsalt (2:3) (9CI) |
| Synonyms: | Arseniousacid (H3AsO3), calcium salt (2:3) (8CI); Calcium arsenite (Ca3As2O6) (6CI) |
| CAS: | 27152-57-4 |
| EINECS: | 248-266-9 |
| Molecular Formula: | AsH3 O3 . 3/2 Ca |
| Molecular Weight: | 366.08 |
| InChI: | InChI=1/AsHO3.Ca/c2-1(3)4;/h2H;/q-2;+2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1574 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | II |
| Flash Point: | °C |
| Safety Data | |
 |
|
