| Identification |
| Name: | Dodecanoic acid, monoester with 1,2,3-propanetriol |
| Synonyms: | Tegin L 90;Glycerol monolaurate;Lauric acid monoglyceride;Sunsoft 757;Dodecanoic acid,esters,monoester with 1,2,3-propanetriol;Sunsoft 750;Aldo MLD-K-FG;Monolaurin;Aldo MLD;Laurin;Monomuls L 90;Monomuls 90L12;Glycerol laurate;Monododecanoyl glycerol;dodecanoic acid; propane-1,2,3-triol;Monoglycerol laurate;Laurin, mono-;Glycerin monolaurate;Cithrol GML;Poem M 200;GML;Grindtek ML 90;Glyceryl laurate SE; |
| CAS: | 27215-38-9 |
| EINECS: | 205-526-6 |
| Molecular Formula: | C15H30O4 |
| Molecular Weight: | 292.4116 |
| InChI: | InChI=1/C12H24O2.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;4-1-3(6)2-5/h2-11H2,1H3,(H,13,14);3-6H,1-2H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.997 g/cm3 |
| Appearance: | Soft solid to yellow liquid |
| Safety Data |
| |
 |
